Option B triglyceride Structure shown is an unsaturated trig

Option B triglyceride. Structure shown is an unsaturated triglyceride having double bonds between two carbon atoms in each carbon chain and ending with -RCOO group which is connected to same another group to form trio of it.

Solution

Identify the class of lipid to which the following molecule belongs. CEI-0-C-(CH):CH=CH--(CH-)-CH3 CH2-0-C-CH)6\" -(CH2-ch-CH)--CH2-CH3 Select one: a. fatty acid b. triglyceride c. wax () d. glycerophospholipid